BD1070348
Cbz-D-allo-isoleucine , 96% , 55723-45-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB196.00 | In Stock |
|
| 5g | RMB702.40 | In Stock |
|
| 25g | RMB2485.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 442.8±38.0 °C(Predicted) |
| Density | 1.158±0.06 g/cm3(Predicted) |
| storage temp. | -15°C |
| pka | 4.02±0.22(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1S/C14H19NO4/c1-3-10(2)12(13(16)17)15-14(18)19-9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3,(H,15,18)(H,16,17)/t10-,12+/m0/s1 |
| InChIKey | JSHXJPFZKBRLFU-CMPLNLGQSA-N |
| SMILES | C(O)(=O)[C@@H]([C@@H](C)CC)NC(OCC1=CC=CC=C1)=O |
Description and Uses
Z-D-Allo-ile-oh dcha is a reactant used in the total synthesis of Tamandarin A, effective against pancreatic carcinoma. Also used in the preparation of new inhibtors of type IV colagenases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P305+P351+P338-P337+P313-P261-P271-P304+P340-P312-P403+P233-P405-P501 |
