BD1096232
1,2-Difluoro-3-(trifluoromethyl)benzene , 98% , 64248-59-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB97.60 | In Stock |
|
| 10g | RMB188.80 | In Stock |
|
| 25g | RMB434.40 | In Stock |
|
| 100g | RMB1560.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 115.9±35.0 °C(Predicted) |
| Density | 1.386±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | liquid |
| color | Clear, almost colourless |
| InChI | InChI=1S/C7H3F5/c8-5-3-1-2-4(6(5)9)7(10,11)12/h1-3H |
| InChIKey | CBOJZWDLNLMBLM-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(C(F)(F)F)=C1F |
| CAS DataBase Reference | 64248-59-5(CAS DataBase Reference) |
Description and Uses
1,2-Difluoro-3-trifluoromethylbenzene
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 1993 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
