PRODUCT Properties
| Melting point: | 96 °C (lit.) |
| Boiling point: | 317.8±42.0 °C(Predicted) |
| Density | 1.502±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -0.01±0.10(Predicted) |
| form | powder |
| color | Faint brown |
| InChI | InChI=1S/C7H6F3NO2S/c8-7(9,10)14(12,13)6-3-1-5(11)2-4-6/h1-4H,11H2 |
| InChIKey | GNVFCXUZQGCXPB-UHFFFAOYSA-N |
| SMILES | C1(N)=CC=C(S(C(F)(F)F)(=O)=O)C=C1 |
| CAS DataBase Reference | 473-27-8(CAS DataBase Reference) |
Description and Uses
4-(Trifluoromethylsulfonyl)aniline may be used in the preparation of 1-azido-4(trifluoromethanesufonyl)benzene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







