BD1129632
2,6-Dichloro-3-nitrobenzonitrile , 98% , 5866-98-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB92.00 | In Stock |
|
| 5g | RMB272.80 | In Stock |
|
| 10g | RMB493.60 | In Stock |
|
| 25g | RMB1184.00 | In Stock |
|
| 100g | RMB3184.00 | In Stock |
|
| 500g | RMB9552.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-109°C |
| Boiling point: | 341.7±42.0 °C(Predicted) |
| Density | 1.61±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Light yellow to light brown Solid |
| BRN | 2113045 |
| InChI | InChI=1S/C7H2Cl2N2O2/c8-5-1-2-6(11(12)13)7(9)4(5)3-10/h1-2H |
| InChIKey | NSKVWZIEYFSHIM-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(Cl)C=CC([N+]([O-])=O)=C1Cl |
| CAS DataBase Reference | 5866-98-8 |
Description and Uses
2,6-Dichloro-3-nitrobenzonitrile is used as a pharmaceutical intermediate for the preparation of inhibitors of HIV replication.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H331-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3439 |
| HazardClass | 6.1 |
| PackingGroup | III |
