BD1129932
2,6-Dichloro-4-(trifluoromethyl)pyridine , 98% , 39890-98-7
CAS NO.:39890-98-7
Empirical Formula: C6H2Cl2F3N
Molecular Weight: 215.99
MDL number: MFCD00042246
EINECS: 201-525-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB53.60 | In Stock |
|
| 5g | RMB178.40 | In Stock |
|
| 10g | RMB332.80 | In Stock |
|
| 25g | RMB806.40 | In Stock |
|
| 100g | RMB3128.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 85°C 40mm |
| Density | 1.505 g/mL at 25 °C |
| refractive index | n20/D 1.473 |
| Flash point: | 70-75°C/25mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | -4.51±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C6H2Cl2F3N/c7-4-1-3(6(9,10)11)2-5(8)12-4/h1-2H |
| InChIKey | KVNQWVYYVLCZKK-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC(Cl)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 39890-98-7(CAS DataBase Reference) |
Description and Uses
2,6-Dichloro-4-(trifluoromethyl)pyridine is a tri-substituted pyridine used in the preparation of pharmaceuticals agents with antitumor activities.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,F,Xi |
| Risk Statements | 36/37/38-25 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN2810 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






