BD1134032
trans-11-Chloro-2-methyl-2,3,3a,12b-tetrahydro-1H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrol-1-one , 97% , 129385-59-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.80 | In Stock |
|
| 5g | RMB164.00 | In Stock |
|
| 10g | RMB282.40 | In Stock |
|
| 25g | RMB577.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150.6 °C |
| Boiling point: | 428.4±45.0 °C(Predicted) |
| Density | 1.311 |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| pka | -0.70±0.20(Predicted) |
| Appearance | White to light yellow Solid |
| InChI | InChI=1/C17H14ClNO2/c1-19-9-13-11-4-2-3-5-14(11)21-15-7-6-10(18)8-12(15)16(13)17(19)20/h2-8,13,16H,9H2,1H3/t13-,16-/s3 |
| InChIKey | OOUVAHYYJVOIIB-PHJLSVTMNA-N |
| SMILES | N1(C)C[C@@]2([H])C3=CC=CC=C3OC3=CC=C(Cl)C=C3[C@]2([H])C1=O |&1:3,19,r| |
Description and Uses
rel-(3aR,12bR)-11-Chloro-2,3,3a,12b-tetrahydro-2-methyl-1H-dibenz[2,3:6,7]oxepino[4,5-c]pyrrol-1-one is a decomposition compound of Org 5222, a new potential antipsychotic compound.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |

![trans-11-Chloro-2-methyl-2,3,3a,12b-tetrahydro-1H-dibenzo[2,3:6,7]oxepino[4,5-c]pyrrol-1-one](https://img.chemicalbook.com/CAS/20180906/GIF/129385-59-7.gif)



