BD1134748
Fmoc-3-Abz-OH , 98% , 185116-42-1
Synonym(s):
3-(Fmoc-amino)benzoic acid
| Pack Size | Price | Stock | Quantity |
| 100g | RMB2116.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 548.3±33.0 °C(Predicted) |
| Density | 1.352±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.13±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 7226236 |
| Major Application | peptide synthesis |
| InChI | 1S/C22H17NO4/c24-21(25)14-6-5-7-15(12-14)23-22(26)27-13-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-12,20H,13H2,(H,23,26)(H,24,25) |
| InChIKey | VFXDSSUGFNVDJP-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc(NC(=O)OCC2c3ccccc3-c4ccccc24)c1 |
| CAS DataBase Reference | 185116-42-1(CAS DataBase Reference) |
Description and Uses
Fmoc-3-aminobenzoic acid is used in the preparation of hydrogelators with multiple applications including; drug delivery carriers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
