BD1135732
H-DL-Gly-OBzl.HCl , 98% , 2462-31-9
Synonym(s):
Benzyl glycinate
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB36.00 | In Stock |
|
| 25g | RMB76.80 | In Stock |
|
| 100g | RMB300.00 | In Stock |
|
| 500g | RMB1415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO, Methanol, Water |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C9H11NO2.ClH/c10-6-9(11)12-7-8-4-2-1-3-5-8;/h1-5H,6-7,10H2;1H |
| InChIKey | VLQHNAMRWPQWNK-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1)COC(=O)CN.Cl |
| CAS DataBase Reference | 2462-31-9(CAS DataBase Reference) |
Description and Uses
Potent crosslinking inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |







