BD1152648
3-Amino-4-methylpyridazine , 95% , 90568-15-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB542.40 | In Stock |
|
| 250mg | RMB809.60 | In Stock |
|
| 1g | RMB2032.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 193.5 °C |
| Boiling point: | 316.8±22.0 °C(Predicted) |
| Density | 1.155±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 5.31±0.10(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C5H7N3/c1-4-2-3-7-8-5(4)6/h2-3H,1H3,(H2,6,8) |
| InChIKey | WDTVJTBXOFGSJT-UHFFFAOYSA-N |
| SMILES | C1(N)=NN=CC=C1C |
Description and Uses
3-Amino-4-methyl-pyridazine is a reactant used in the synthesis of antiinflammatory agents such as 2-?phenylimidazo[1,?2-?b]?pyridazine-?3-?acetic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933998090 |
