BD1158732
Ethyl 7-chloro-2-oxoheptanoate , 97% , 78834-75-0
CAS NO.:78834-75-0
Empirical Formula: C9H15ClO3
Molecular Weight: 206.67
MDL number: MFCD07698675
EINECS: 278-992-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB28.80 | In Stock |
|
| 10g | RMB47.20 | In Stock |
|
| 25g | RMB115.20 | In Stock |
|
| 100g | RMB452.80 | In Stock |
|
| 500g | RMB1733.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 281.2±23.0 °C(Predicted) |
| Density | 1.093±0.06 g/cm3(Predicted) |
| refractive index | 1.4510 to 1.4560 |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear Yellow |
| InChI | InChI=1S/C9H15ClO3/c1-2-13-9(12)8(11)6-4-3-5-7-10/h2-7H2,1H3 |
| InChIKey | YJJLIIMRHGRCFM-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(=O)CCCCCCl |
| CAS DataBase Reference | 78834-75-0(CAS DataBase Reference) |
Description and Uses
Ethyl 7-chloro-2-oxoheptanoate is a product of the Grignard reaction that can be used to synthesize organic compounds. It has been used in the preparation of pharmaceuticals such as cilastatin, which is used to inhibit cytochrome P450 enzymes in order to prolong the effectiveness of other drugs. This reagent also reacts with hydrochloric acid to form ethyl chloride and heptanoic acid, which can be used for chlorination reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H302-H332-H319-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312 |
| WGK Germany | WGK 3 |
| HS Code | 2918300090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






