BD1166432
(S)-2-Amino-3-cyclohexylpropanoic acid , 97% , 27527-05-5
CAS NO.：27527-05-5
Empirical Formula: C9H17NO2
Molecular Weight: 171.24
MDL number: MFCD00190861
EINECS: 1308068-626-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB59.20 | In Stock |
|
| 10g | RMB99.20 | In Stock |
|
| 25g | RMB228.00 | In Stock |
|
| 100g | RMB783.20 | In Stock |
|
| 500g | RMB3416.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 322 °C |
| Boiling point: | 307.1±25.0 °C(Predicted) |
| Density | 1.075±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| pka | 2.33±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1/C9H17NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h7-8H,1-6,10H2,(H,11,12)/t8-/s3 |
| InChIKey | ORQXBVXKBGUSBA-SBYBRXNCNA-N |
| SMILES | C1(CCCCC1)C[C@H](N)C(=O)O |&1:7,r| |
| CAS DataBase Reference | 27527-05-5(CAS DataBase Reference) |
Description and Uses
(S)-(+)-Cyclohexylalanine
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-37/39-26 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HS Code | 2922498590 |
