BD1169432
2-Azabicyclo[2.2.1]heptane , 98% , 279-24-3
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB313.60 | In Stock |
|
| 100mg | RMB438.40 | In Stock |
|
| 250mg | RMB656.80 | In Stock |
|
| 1g | RMB1013.60 | In Stock |
|
| 5g | RMB3040.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-80 °C |
| Boiling point: | 135 °C |
| Density | 0.959±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | solid |
| pka | 11.44±0.20(Predicted) |
| color | Brown |
| InChI | InChI=1S/C6H11N/c1-2-6-3-5(1)4-7-6/h5-7H,1-4H2 |
| InChIKey | GYLMCBOAXJVARF-UHFFFAOYSA-N |
| SMILES | C12CC(CC1)CN2 |
| CAS DataBase Reference | 279-24-3 |
Description and Uses
4-Formyl-3-methylbenzoic Acid is used in the synthesis of novel alkylaminomethyl substituted Ph and thienyl derivatives as potent SIPR1 agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41-52 |
| Safety Statements | 26-39 |
| HS Code | 2902900000 |

![2-Azabicyclo[2.2.1]heptane](https://img.chemicalbook.com/CAS/GIF/279-24-3.gif)

![rel-(1R,4S,7R)-Ethyl2-benzyl-2-azabicyclo[2.2.1]heptane-7-carboxylate](https://img.chemicalbook.com/CAS/GIF/745836-32-2.gif)

![(1R,4S,7R)-rel-ethyl2-azabicyclo[2.2.1]heptane-7-carboxylate](https://img.chemicalbook.com/CAS/GIF/745836-21-9.gif)
![rel-(1R,4R,7R)-2-Benzyl-7-bromo-2-azabicyclo[2.2.1]heptane](https://img.chemicalbook.com/CAS/GIF/312955-00-3.gif)
