BD1169832
1-Cyclopentylpiperazine , 97% , 21043-40-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB68.00 | In Stock |
|
| 5g | RMB241.60 | In Stock |
|
| 25g | RMB867.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 48 °C |
| Density | 0.989±0.06 g/cm3(Predicted) |
| refractive index | 1.5000 to 1.5040 |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Oil to Gel |
| pka | 9.28±0.10(Predicted) |
| color | Colourless to Pale Yellow |
| InChI | InChI=1S/C9H18N2/c1-2-4-9(3-1)11-7-5-10-6-8-11/h9-10H,1-8H2 |
| InChIKey | PVMCQBPJKPMOKM-UHFFFAOYSA-N |
| SMILES | N1(C2CCCC2)CCNCC1 |
| CAS DataBase Reference | 21043-40-3(CAS DataBase Reference) |
Description and Uses
1-Cyclopentylpiperazine is used in the synthesis of quinolines as a new class of imidazole-free H3 receptor antagonists. Also used to prepare a series of estrogen receptor modulators.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |






