BD1211932
6-Methoxybenzo[d]thiazole-2-carbonitrile , 96% , 943-03-3
Synonym(s):
6-Methoxy-2-benzothiazolecarbonitrile
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB36.80 | In Stock |
|
| 250mg | RMB48.00 | In Stock |
|
| 1g | RMB134.40 | In Stock |
|
| 5g | RMB663.20 | In Stock |
|
| 25g | RMB3098.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-131 °C (lit.) |
| Boiling point: | 334.9±34.0 °C(Predicted) |
| Density | 1.2938 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: soluble5%, clear, colorless to faintly yellow |
| form | Crystalline Powder |
| pka | -1.49±0.10(Predicted) |
| color | Off-white to light yellow |
| InChI | InChI=1S/C9H6N2OS/c1-12-6-2-3-7-8(4-6)13-9(5-10)11-7/h2-4H,1H3 |
| InChIKey | DEWDWBYQOFXKIH-UHFFFAOYSA-N |
| SMILES | S1C2=CC(OC)=CC=C2N=C1C#N |
| CAS DataBase Reference | 943-03-3(CAS DataBase Reference) |
Description and Uses
2-Cyano-6-methoxybenzothiazole is a building block for synthesis of luciferins.
2-Cyano-6-methoxybenzothiazole has been used in the synthesis of:
- firefly luciferin via condensation with cysteine
- luciferin β-glycosides, substrates for novel ultrasensitive enzyme assays
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HS Code | 29341000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![6-Methoxybenzo[d]thiazole-2-carbonitrile](https://img.chemicalbook.com/CAS/GIF/943-03-3.gif)



