BD1218332
2-Ethylhexyl stearate , 97% , 22047-49-0
CAS NO.:22047-49-0
Empirical Formula: C26H52O2
Molecular Weight: 396.69
MDL number: MFCD00072275
EINECS: 244-754-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB38.40 | In Stock |
|
| 25g | RMB76.00 | In Stock |
|
| 100g | RMB242.40 | In Stock |
|
| 500g | RMB821.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 420.33°C (rough estimate) |
| Density | 0.8789 (rough estimate) |
| vapor pressure | 0Pa at 20℃ |
| refractive index | 1.4563 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Hexanes (Slightly) |
| form | Oil |
| color | Colourless |
| Specific Gravity | 0.826 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT |
| InChI | InChI=1S/C26H52O2/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-23-26(27)28-24-25(6-3)22-8-5-2/h25H,4-24H2,1-3H3 |
| InChIKey | OPJWPPVYCOPDCM-UHFFFAOYSA-N |
| SMILES | C(OCC(CC)CCCC)(=O)CCCCCCCCCCCCCCCCC |
| LogP | 11.994 (est) |
| EPA Substance Registry System | 2-Ethylhexyl stearate (22047-49-0) |
Description and Uses
2-Ethylhexyl Stearate is a cream-type cleansing cosmetic compound containing large amount of oil phase and its manufacturing method.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| TSCA | TSCA listed |
| Toxicity | skn-rbt 500 mg MLD JACTDZ 4(5),107,85 |



