BD1222632
2-Fluoropyridin-4-ol , 97% , 22282-69-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB58.40 | In Stock |
|
| 250mg | RMB112.00 | In Stock |
|
| 1g | RMB383.20 | In Stock |
|
| 5g | RMB1568.80 | In Stock |
|
| 10g | RMB3041.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-149℃ |
| Boiling point: | 377.4±22.0 °C(Predicted) |
| Density | 1.325±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 8.05±0.10(Predicted) |
| Appearance | White to light brown Solid |
| InChI | InChI=1S/C5H4FNO/c6-5-3-4(8)1-2-7-5/h1-3H,(H,7,8) |
| InChIKey | BRLSDLHMGRDAPF-UHFFFAOYSA-N |
| SMILES | C1(F)=NC=CC(O)=C1 |
Description and Uses
2-Fluoropyridin-4-ol is a fluoronated pyridine that is used in the synthesis of herbicides and horticultural fungicides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| HS Code | 2933399990 |
