BD1268332
2-Methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine , 95% , 660867-80-1
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB39.20 | In Stock |
|
| 1g | RMB92.80 | In Stock |
|
| 5g | RMB362.40 | In Stock |
|
| 10g | RMB648.00 | In Stock |
|
| 25g | RMB1572.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-71°C |
| Boiling point: | 315.9±30.0 °C(Predicted) |
| Density | 1.02 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.11±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C12H18BNO2/c1-9-8-10(6-7-14-9)13-15-11(2,3)12(4,5)16-13/h6-8H,1-5H3 |
| InChIKey | MBTULFIFECUURA-UHFFFAOYSA-N |
| SMILES | Cc1cc(ccn1)B2OC(C)(C)C(C)(C)O2 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | WGK 3 |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |







