BD1274732
2,4-Dimethoxybenzonitrile , 98% , 4107-65-7
CAS NO.:4107-65-7
Empirical Formula: C9H9NO2
Molecular Weight: 163.17
MDL number: MFCD00001786
EINECS: 223-886-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB26.40 | In Stock |
|
| 5g | RMB88.80 | In Stock |
|
| 10g | RMB156.00 | In Stock |
|
| 25g | RMB380.00 | In Stock |
|
| 100g | RMB1376.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-94 °C (lit.) |
| Boiling point: | 290.25°C (rough estimate) |
| Density | 1.2021 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | White to slightly yellow |
| BRN | 1950512 |
| InChI | InChI=1S/C9H9NO2/c1-11-8-4-3-7(6-10)9(5-8)12-2/h3-5H,1-2H3 |
| InChIKey | RYRZSQQELLQCMZ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(OC)C=C1OC |
| CAS DataBase Reference | 4107-65-7(CAS DataBase Reference) |
Description and Uses
2,4-Dimethoxybenzonitrile was used in the preparation of 2,4-dimethoxybenzylamine.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36-36/37 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







