BD1279932
2-Phenylisonicotinic acid , 98% , 55240-51-2
CAS NO.：55240-51-2
Empirical Formula: C12H9NO2
Molecular Weight: 199.21
MDL number: MFCD03086008
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB176.80 | In Stock |
|
| 1g | RMB459.20 | In Stock |
|
| 5g | RMB1607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-271 °C |
| Boiling point: | 478.8±33.0 °C(Predicted) |
| Density | 1.241±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystal |
| pka | 1.89±0.10(Predicted) |
| color | White to Orange to Green |
| InChI | 1S/C12H9NO2/c14-12(15)10-6-7-13-11(8-10)9-4-2-1-3-5-9/h1-8H,(H,14,15) |
| InChIKey | OMMKWOVBOKXXQU-UHFFFAOYSA-N |
| SMILES | OC(C1=CC(C2=CC=CC=C2)=NC=C1)=O |
| CAS DataBase Reference | 55240-51-2 |
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P405-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2933399990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
