BD1291832
3-(1,3-Dioxoisoindolin-2-yl)propanal , 95% , 2436-29-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB36.00 | In Stock |
|
| 250mg | RMB54.40 | In Stock |
|
| 1g | RMB136.00 | In Stock |
|
| 5g | RMB404.00 | In Stock |
|
| 10g | RMB623.20 | In Stock |
|
| 25g | RMB1058.40 | In Stock |
|
| 100g | RMB3492.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-141 ºC |
| Boiling point: | 352.7±25.0 °C(Predicted) |
| Density | 1.319±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | solid |
| pka | -2.24±0.20(Predicted) |
| color | White |
| InChI | InChI=1S/C11H9NO3/c13-7-3-6-12-10(14)8-4-1-2-5-9(8)11(12)15/h1-2,4-5,7H,3,6H2 |
| InChIKey | IBSDSIHTMABATG-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCC=O |
| CAS DataBase Reference | 2436-29-5(CAS DataBase Reference) |
Description and Uses
3-(1,3-Dioxoisoindol-2-yl)propanal is an aldehyde organic compound, which can be used as a pharmaceutical intermediate.
3-(1,3-Dioxoisoindol-2-yl)propanal is a key intermediate in the preparation of atorvastatin (Lipitor).
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302+H312-H317-H319-H411 |
| Precautionary statements | P280-P301+P310-P302+P350-P302+P352-P305+P351+P338-P321 |
| Hazard Codes | Xn |
| Risk Statements | 22-36-43 |
| Safety Statements | 26-36/37 |
| HS Code | 2909498090 |
| Toxicity | mouse,LD50,intraperitoneal,1055mg/kg (1055mg/kg),BEHAVIORAL: SOMNOLENCE (GENERAL DEPRESSED ACTIVITY),Journal of Pharmaceutical Sciences. Vol. 57, Pg. 815, 1968. |
