BD1310632
(2-Cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)methanol , 97% , 121660-11-5
CAS NO.:121660-11-5
Empirical Formula: C19H16FNO
Molecular Weight: 293.33
MDL number: MFCD09032924
EINECS: 601-797-3
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB24.00 | In Stock |
|
| 250mg | RMB28.80 | In Stock |
|
| 1g | RMB71.20 | In Stock |
|
| 5g | RMB268.00 | In Stock |
|
| 10g | RMB492.00 | In Stock |
|
| 25g | RMB1116.80 | In Stock |
|
| 100g | RMB2481.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134-136°C |
| Density | 1.286 |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Yellow |
| InChI | InChI=1S/C19H16FNO/c20-14-9-7-12(8-10-14)18-15-3-1-2-4-17(15)21-19(13-5-6-13)16(18)11-22/h1-4,7-10,13,22H,5-6,11H2 |
| InChIKey | FIZDBNPUFMDGFZ-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2)C(C2=CC=C(F)C=C2)=C(CO)C=1C1CC1 |
| CAS DataBase Reference | 121660-11-5(CAS DataBase Reference) |
Description and Uses
Pitavastatin intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |







