BD1310832
3-(Chlorosulfonyl)-4-methoxybenzoic acid , 95% , 50803-29-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB151.20 | In Stock |
|
| 250mg | RMB254.40 | In Stock |
|
| 1g | RMB635.20 | In Stock |
|
| 5g | RMB2365.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178 °C |
| Boiling point: | 428.8±35.0 °C(Predicted) |
| Density | 1.541±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO; DMF; THF; Methanol; Ethyl Acetate; |
| form | Solid |
| pka | 3.27±0.10(Predicted) |
| color | Off-white |
| InChI | InChI=1S/C8H7ClO5S/c1-14-6-3-2-5(8(10)11)4-7(6)15(9,12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | OWBBPHXIAFVUMO-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OC)C(S(Cl)(=O)=O)=C1 |
Description and Uses
3-(Chlorosulfonyl)-4-methoxy-benzoic Acid is an intermediate used in the synthesis of 5-Formyl-2-methoxy-benzenesulfonamide (F700730), which is an impurity of Tamsulosin (T006350), a specific α1-adrenoceptor antagonist used in the treatment of benign prostatic hypertrophy.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
