BD1321032
3,3-Bis(bromomethyl)oxetane , 95% , 2402-83-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB92.80 | In Stock |
|
| 10g | RMB180.00 | In Stock |
|
| 25g | RMB393.60 | In Stock |
|
| 100g | RMB1164.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25℃ |
| Boiling point: | 125℃ (23 Torr) |
| Density | 1.83 g/cm3(Temp: 25 °C) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Solid |
| color | Colourless to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H8Br2O/c6-1-5(2-7)3-8-4-5/h1-4H2 |
| InChIKey | QOPMHMFIIMJWET-UHFFFAOYSA-N |
| SMILES | O1CC(CBr)(CBr)C1 |
| EPA Substance Registry System | Oxetane, 3,3-bis(bromomethyl)- (2402-83-7) |
Description and Uses
3,3-Bis(bromomethyl)oxetane is a useful research chemical used in the preparation of tetrahydrofuran/thiolane derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 34-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| HS Code | 2932990090 |
