BD1336032
4,6-Difluoroindole-2-carboxylic acid , 97% , 247564-66-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB44.00 | In Stock |
|
| 1g | RMB100.80 | In Stock |
|
| 5g | RMB482.40 | In Stock |
|
| 10g | RMB918.40 | In Stock |
|
| 25g | RMB2099.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 414.7±40.0 °C(Predicted) |
| Density | 1.605±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.25±0.30(Predicted) |
| Appearance | Off-white to light brown Solid |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C9H5F2NO2/c10-4-1-6(11)5-3-8(9(13)14)12-7(5)2-4/h1-3,12H,(H,13,14) |
| InChIKey | OCHGGXDZJGAUEU-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(F)=CC(F)=C2)C=C1C(O)=O |
| CAS DataBase Reference | 247564-66-5(CAS DataBase Reference) |
Description and Uses
4,6-Difluoroindole-2-carboxylic acid is an important fluorinated indole heterocyclic pharmaceutical intermediate, mainly used in new drug development. It can be used to synthesize indole candidate drugs with anti-inflammatory, anti-tumor and targeted biological activities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| HS Code | 2933998090 |







