BD1363332
5-Nitronicotinic acid , 97% , 2047-49-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB96.80 | In Stock |
|
| 1g | RMB255.20 | In Stock |
|
| 5g | RMB1230.40 | In Stock |
|
| 10g | RMB2036.00 | In Stock |
|
| 25g | RMB4095.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-173 |
| Boiling point: | 369.5±27.0 °C(Predicted) |
| Density | 1.570±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 2.75±0.10(Predicted) |
| color | Light Yellow to Dark Yellow |
| InChI | InChI=1S/C6H4N2O4/c9-6(10)4-1-5(8(11)12)3-7-2-4/h1-3H,(H,9,10) |
| InChIKey | TZAGBVHIUUFVCJ-UHFFFAOYSA-N |
| SMILES | C1=NC=C([N+]([O-])=O)C=C1C(O)=O |
| CAS DataBase Reference | 2047-49-6(CAS DataBase Reference) |
Description and Uses
An intermediate in the synthesis of nicotinamide with potential anticoccidial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| Hazard Note | Irritant |
| HS Code | 29349990 |
