BD1392832
3-Chloro-4-methylphenol , 97% , 615-62-3
CAS NO.:615-62-3
Empirical Formula: C7H7ClO
Molecular Weight: 142.58
MDL number: MFCD00060319
EINECS: 210-439-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB63.20 | In Stock |
|
| 10g | RMB113.60 | In Stock |
|
| 25g | RMB232.00 | In Stock |
|
| 100g | RMB898.40 | In Stock |
|
| 500g | RMB3580.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48-53 °C |
| Boiling point: | 228 °C |
| Density | 0,963g/cm |
| refractive index | 1,403 |
| Flash point: | 228°C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to lump |
| pka | 9.30±0.18(Predicted) |
| color | Light yellow to Amber to Dark green |
| λmax | 283nm(H2O)(lit.) |
| InChI | InChI=1S/C7H7ClO/c1-5-2-3-6(9)4-7(5)8/h2-4,9H,1H3 |
| InChIKey | VQZRLBWPEHFGCD-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(C)C(Cl)=C1 |
| CAS DataBase Reference | 615-62-3(CAS DataBase Reference) |
| EPA Substance Registry System | Phenol, 3-chloro-4-methyl- (615-62-3) |
Description and Uses
3-Chloro-4-methylphenol is used in preparation of (Carbonyl)benzylthiadiazoles as herbicides.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H318-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | C,T,Xi,Xn |
| Risk Statements | 20/21/22-36/37/38-38-21/22-41-37/38 |
| Safety Statements | 23-36/37/39-28-26-39 |
| RIDADR | 3437 |
| WGK Germany | 3 |
| Hazard Note | Toxic/Corrosive |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29089990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |







