BD1409148
4,4,5,5,6,6,7,7,7-Nonafluoroheptan-1-ol , 95% , 83310-97-8
Synonym(s):
3-(Perfluorobutyl)propanol
| Pack Size | Price | Stock | Quantity |
| 5g | RMB224.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -60--55℃ |
| Boiling point: | 163-164 °C(lit.) |
| Density | 1.528 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 170 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 14.79±0.10(Predicted) |
| color | Colourless |
| InChI | InChI=1S/C7H7F9O/c8-4(9,2-1-3-17)5(10,11)6(12,13)7(14,15)16/h17H,1-3H2 |
| InChIKey | OVBNEUIFHDEQHD-UHFFFAOYSA-N |
| SMILES | C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 83310-97-8(CAS DataBase Reference) |
| EPA Substance Registry System | 3-(Perfluorobutyl)-1-propanol (83310-97-8) |
Description and Uses
4,4,5,5,6,6,7,7,7-Nonafluoroheptan-1-ol is used in preparation of fluoroalkyl vinyl ether by reaction of fluorinated alcohol with divinyl ether and/or trivinyl ether.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2905190098 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



![Tridecafluoroheptanoic Acid High Grade [Ion-Pair Reagent for LC-MS]](https://img.chemicalbook.com/CAS/GIF/375-85-9.gif)


