BD1437132
6-Isopropylpyridin-3-amine , 97% , 405103-02-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB152.80 | In Stock |
|
| 250mg | RMB279.20 | In Stock |
|
| 1g | RMB559.20 | In Stock |
|
| 5g | RMB2684.80 | In Stock |
|
| 25g | RMB9312.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 255.1±20.0 °C(Predicted) |
| Density | 1.008±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 6.77±0.10(Predicted) |
| Appearance | Light yellow to brown Liquid |
| InChI | InChI=1S/C8H12N2/c1-6(2)8-4-3-7(9)5-10-8/h3-6H,9H2,1-2H3 |
| InChIKey | XYGFISRAXLLACA-UHFFFAOYSA-N |
| SMILES | C1=NC(C(C)C)=CC=C1N |
Description and Uses
6-Isopropylpyridin-3-amine is used to prepare quinolinonecarboxamides as modulators of ATP-binding cassette transporters.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933399990 |
