BD1439548
Ethyl1,3-dithiane-2-carboxylate , 98% , 20462-00-4
Synonym(s):
Glyoxylic acid ethyl ester trimethylenemercaptal
CAS NO.:20462-00-4
Empirical Formula: C7H12O2S2
Molecular Weight: 192.3
MDL number: MFCD00006657
EINECS: 243-838-4
| Pack Size | Price | Stock | Quantity |
| 500g | RMB3673.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 19-21°C |
| Boiling point: | 75-77 °C/0.2 mmHg (lit.) |
| Density | 1.22 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 130 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Slightly miscible with water. |
| BRN | 1424352 |
| InChI | InChI=1S/C7H12O2S2/c1-2-9-6(8)7-10-4-3-5-11-7/h7H,2-5H2,1H3 |
| InChIKey | ANEDZEVDORCLPM-UHFFFAOYSA-N |
| SMILES | S1CCCSC1C(OCC)=O |
| CAS DataBase Reference | 20462-00-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyl 1,3-dithiane-2-carboxylate(20462-00-4) |
Description and Uses
Ethyl 1,3-dithiane-2-carboxylate is used in syn-selective aldol reactions. It undergoes asymmetric oxidation to give trans bis-sulfoxide. It is used to generate carbanon, which finds application in the preparation of alfa- keto esters.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P241-P280a-P501a-P210-P233-P240-P241+P242+P243-P280-P303+P361+P353-P403+P235-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Risk Statements | 10 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| F | 9-13 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |




