BD1496132
3-Amino-1H-pyrazole-4-carboxylic acid , 95% , 41680-34-6
CAS NO.：41680-34-6
Empirical Formula: C4H5N3O2
Molecular Weight: 127.1
MDL number: MFCD00005239
EINECS: 255-493-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB38.40 | In Stock |
|
| 5g | RMB140.00 | In Stock |
|
| 10g | RMB269.60 | In Stock |
|
| 25g | RMB656.80 | In Stock |
|
| 100g | RMB2276.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 135 °C (dec.) (lit.) |
| Boiling point: | 235.85°C (rough estimate) |
| Density | 1.4748 (rough estimate) |
| refractive index | 1.5000 (estimate) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 15.28±0.50(Predicted) |
| color | White |
| InChI | InChI=1S/C4H5N3O2/c5-3-2(4(8)9)1-6-7-3/h1H,(H,8,9)(H3,5,6,7) |
| InChIKey | KMRVTZLKQPFHFS-UHFFFAOYSA-N |
| SMILES | N1C=C(C(O)=O)C(N)=N1 |
| CAS DataBase Reference | 41680-34-6(CAS DataBase Reference) |
Description and Uses
3-Amino-1H-pyrazole-4-carboxylic Acid, is a heterocyclic building block used for the synthesis of more complex pharmaceutical and biologically active compounds, including inhibitors. It can be used for the preparation of some impurities and/or degradation products of Zaleplon (Z145000), and also for Arylsulfonamidopiperidone derivatives as a novel class of factor Xa inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | UQ6390000 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
