![6-Bromobenzo[de]isochromene-1,3-dione](https://img.chemicalbook.com/CAS/GIF/81-86-7.gif)
BD1501432
6-Bromobenzo[de]isochromene-1,3-dione , 96% , 81-86-7
CAS NO.：81-86-7
Empirical Formula: C12H5BrO3
Molecular Weight: 277.07
MDL number: MFCD00006927
EINECS: 201-382-3
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 10g | RMB28.80 | In Stock |
|
| 25g | RMB35.20 | In Stock |
|
| 100g | RMB68.80 | In Stock |
|
| 500g | RMB300.00 | In Stock |
|
| 1000g | RMB528.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217-219 °C (lit.) |
| Boiling point: | 467.2±28.0 °C(Predicted) |
| Density | 1.812±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Yellow |
| InChI | InChI=1S/C12H5BrO3/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)16-12(8)15/h1-5H |
| InChIKey | DTUOTSLAFJCQHN-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC=C(Br)C3=C2C1=CC=C3 |
| CAS DataBase Reference | 81-86-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H,3H-Naphtho[1,8-cd]pyran-1,3-dione, 6-bromo- (81-86-7) |
Description and Uses
4-Bromo-1,8-naphthalic Anhydride is used as a starting material in the synthesis of a fluorescent probe for the detection of copper ions in living human LO-2 cell lines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29173990 |
