BD1530232
4-Chloro-7-fluoroquinazoline , 95% , 16499-62-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB76.80 | In Stock |
|
| 1g | RMB186.40 | In Stock |
|
| 5g | RMB511.20 | In Stock |
|
| 25g | RMB2448.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 284.9±20.0 °C(Predicted) |
| Density | 1.447 |
| refractive index | 1.635 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 0.35±0.30(Predicted) |
| Appearance | White to yellow Solid |
| InChI | InChI=1S/C8H4ClFN2/c9-8-6-2-1-5(10)3-7(6)11-4-12-8/h1-4H |
| InChIKey | JHBYQJRHJVEKPK-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC(F)=C2)=C(Cl)N=C1 |
Description and Uses
4-chloro-7-fluoro-quinazoline is a white crystalline solid. It can be dissolved in organic solvents such as ethanol and dimethylformamide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
