BD1538832
N-Methyl-D-prolinol , 95% , 99494-01-6
Synonym(s):
(R)-2-Hydroxymethyl-1-methylpyrrolidine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB30.40 | In Stock |
|
| 5g | RMB113.60 | In Stock |
|
| 10g | RMB209.60 | In Stock |
|
| 25g | RMB390.40 | In Stock |
|
| 100g | RMB1329.60 | In Stock |
|
| 500g | RMB4696.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.971 g/mL at 25 °C |
| refractive index | n20/D4.469 |
| Flash point: | 71℃ |
| storage temp. | 2-8°C |
| pka | 14.77±0.10(Predicted) |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| optical activity | Consistent with structure |
| Boiling point: | 68-71°C(lit.) |
| InChI | InChI=1S/C6H13NO/c1-7-4-2-3-6(7)5-8/h6,8H,2-5H2,1H3/t6-/m1/s1 |
| InChIKey | VCOJPHPOVDIRJK-ZCFIWIBFSA-N |
| SMILES | N1(C)CCC[C@@H]1CO |
Description and Uses
N-Methyl-D-prolinol is used as a pharmaceutical or synthetic intermediate component in the preparation of organic compounds such as nitrogen-containing heterocyclic compounds, pyrotinib intermediate and anidulafungin derivative.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






