BD1541732
5-Bromo-2-chloro-1,3-difluorobenzene , 97% , 176673-72-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB56.80 | In Stock |
|
| 10g | RMB86.40 | In Stock |
|
| 25g | RMB198.40 | In Stock |
|
| 100g | RMB780.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 190.5±35.0 °C(Predicted) |
| Density | 1.805±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, faint yellow |
| InChI | InChI=1S/C6H2BrClF2/c7-3-1-4(9)6(8)5(10)2-3/h1-2H |
| InChIKey | SWELJVAWQMCJLG-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(Br)=CC(F)=C1Cl |
| CAS DataBase Reference | 176673-72-6(CAS DataBase Reference) |
Description and Uses
4-Chloro-3,5-difluorobromobenzene has various uses in chemical synthesis, especially as a synthetic intermediate in the fields of medicine and pesticide chemistry, and can be used to synthesize complex molecules with specific biological activities, such as drug molecules, hormones or bioactive molecules.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H290 |
| Precautionary statements | P501-P234-P264-P280-P390-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P406-P405 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| Hazard Note | Irritant |
| HS Code | 2903998090 |







