BD1555132
2,3,6-Trifluorophenylboronic acid , 98% , 247564-71-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB69.60 | In Stock |
|
| 5g | RMB248.00 | In Stock |
|
| 25g | RMB1223.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 127-132 °C (lit.) |
| Boiling point: | 266.0±50.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 7.09±0.58(Predicted) |
| form | solid |
| color | Off White |
| InChI | InChI=1S/C6H4BF3O2/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2,11-12H |
| InChIKey | IWPDDRPLEKURGG-UHFFFAOYSA-N |
| SMILES | B(C1=C(F)C=CC(F)=C1F)(O)O |
| CAS DataBase Reference | 247564-71-2(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Synthesis of C-6 hydroxy tricyclic sulfone as a γ-secretase inhibitor via Suzuki coupling reaction
- Palladium catalyzed Suzuki-Miyaura coupling reactions
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280-P261-P271 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2931900090 |
