PRODUCT Properties
| Melting point: | 196 °C |
| Boiling point: | 355.4±42.0 °C(Predicted) |
| Density | 1.208±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.79±0.20(Predicted) |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C9H9NO2/c1-12-8-4-2-3-7-6(8)5-9(11)10-7/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | WINOEVFNWAEXIF-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(OC)=CC=C2)CC1=O |
Description and Uses
4-Methoxy-2-indolone is often used as an intermediate in organic synthesis and has potential biological activity for the development of new drug molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H332-H302-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312-P264-P280-P302+P352-P321-P332+P313-P362 |
| HS Code | 2933998090 |
