BD1653148
Ethyl2-acetamido-2-cyanoacetate , 98% , 4977-62-2
Synonym(s):
N-Acetyl-2-cyanoglycine ethyl ester
CAS NO.:4977-62-2
Empirical Formula: C7H10N2O3
Molecular Weight: 170.17
MDL number: MFCD00009133
EINECS: 225-624-2
| Pack Size | Price | Stock | Quantity |
| 25g | RMB1234.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 125-130 °C(lit.) |
| Boiling point: | 347.5±27.0 °C(Predicted) |
| Density | 1.155±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 15.93±0.46(Predicted) |
| form | powder |
| color | white to off-white |
| BRN | 879845 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C7H10N2O3/c1-3-12-7(11)6(4-8)9-5(2)10/h6H,3H2,1-2H3,(H,9,10) |
| InChIKey | SLIRLABNGAZSHX-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(NC(C)=O)C#N |
| CAS DataBase Reference | 4977-62-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Glycine, n-acetyl-2-cyano-, ethyl ester(4977-62-2) |
Description and Uses
Synthesis of amino acids and related compounds.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |





