BD1660049
Diphenylphosphinicchloride , 97% , 1499-21-4
Synonym(s):
Diphenylphosphinyl chloride;Diphenylphosphorus oxychloride;Ph2POCl;Chlorodiphenylphosphine oxide;Diphenylchlorophosphine oxide
CAS NO.:1499-21-4
Empirical Formula: C12H10ClOP
Molecular Weight: 236.63
MDL number: MFCD00002077
EINECS: 216-107-2
| Pack Size | Price | Stock | Quantity |
| 25g | RMB52.00 | In Stock |
|
| 100g | RMB157.60 | In Stock |
|
| 500g | RMB718.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 20°C |
| Boiling point: | 222 °C/16 mmHg (lit.) |
| Density | 1.24 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 79 °F |
| storage temp. | 2-8°C |
| solubility | soluble in Chloroform, methanol |
| form | Liquid |
| Specific Gravity | 1.24 |
| color | Clear colorless to yellow |
| Water Solubility | decomposes |
| Sensitive | Moisture Sensitive |
| BRN | 975191 |
| InChI | 1S/C12H10ClOP/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | QPQGTZMAQRXCJW-UHFFFAOYSA-N |
| SMILES | ClP(=O)(c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 1499-21-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Diphenylphosphinic chloride(1499-21-4) |
Description and Uses
Diphenylphosphinic chloride (Ph2POCl) is widely used as a precursor to synthesize various chiral phosphine bidentate ligands for asymmetric synthesis, in addition to several peptide coupling agents.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P280-P303+P361+P353-P305+P351+P338+P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F |
| Risk Statements | 10-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Flammable/Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310095 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B Skin Sens. 1A |





