BD1941048
4,4'-((4H-1,2,4-Triazol-4-yl)methylene)dibenzonitrile , 95+% , 112809-52-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB6996.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-243 °C |
| Boiling point: | 563.5±60.0 °C(Predicted) |
| Density | 1.21±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly, Heated), Methanol (Slightly) |
| form | Solid |
| pka | 2.48±0.10(Predicted) |
| color | Off-White to Pale Yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-11-20-21-12-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H |
| InChIKey | BCTXUGAAOFIJGX-UHFFFAOYSA-N |
| SMILES | [n]3(cnnc3)C(c2ccc(cc2)C#N)c1ccc(cc1)C#N |
Description and Uses
Isoletrozole (Letrozole EP Impurity A) is an impurity of Letrozole (L330100). Letrozole impurity A as per USP.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H361fd-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2933998350 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Repr. 2 STOT RE 2 |
![4-[[3-Chloro-4-(2-pyridinylmethoxy)phenyl]amino]-7-ethoxy-6-[(1-methyl-2-pyrrolidinylidene)amino]-3-quinolinecarbonitrile](https://img.chemicalbook.com/CAS/20200611/GIF/1144516-21-1.gif)
