BD1955948
2,2-Difluoroacetamide , 98% , 359-38-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB41.60 | In Stock |
|
| 5g | RMB86.40 | In Stock |
|
| 25g | RMB228.80 | In Stock |
|
| 100g | RMB899.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51.8 °C |
| Boiling point: | 108.63 °C(Press: 35 Torr) |
| Density | 1.291±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Sparingly), Water (Slightly) |
| form | Solid |
| pka | 13.16±0.50(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C2H3F2NO/c3-1(4)2(5)6/h1H,(H2,5,6) |
| InChIKey | ZMIBIIAWFMCVFD-UHFFFAOYSA-N |
| SMILES | C(N)(=O)C(F)F |
| CAS DataBase Reference | 359-38-6(CAS DataBase Reference) |
Description and Uses
2,2-difluoroacetamide is a useful research chemical for the preparation of dihydroperfluoroalkyl amines and other fluoro derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 2924190090 |
