PRODUCT Properties
| Melting point: | 266 °C |
| Density | 1.6705 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.7000 (estimate) |
| storage temp. | 2-8°C |
| solubility | 2.629g/L in organic solvents at 20 ℃ |
| pka | -1.61±0.45(Predicted) |
| Water Solubility | 105.4g/L at 37℃ |
| InChI | InChI=1S/C14H10N2O10S2/c17-15(18)11-5-3-9(13(7-11)27(21,22)23)1-2-10-4-6-12(16(19)20)8-14(10)28(24,25)26/h1-8H,(H,21,22,23)(H,24,25,26) |
| InChIKey | UETHPMGVZHBAFB-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O)=CC1=CC=C([N+]([O-])=O)C=C1S(O)(=O)=O |
| LogP | -0.248 at 37℃ |
| CAS DataBase Reference | 128-42-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, 2,2'-(1,2-ethenediyl)bis[5-nitro- (128-42-7) |
Description and Uses
4,4'-Dinitrostilbene-2,2'-disulfonic acid is used as a chemical intermediate and a precursor of various textile dyes and fluorescent brighteners. It can also react with aniline derivatives to prepare Direct Yellow 12 azo dye.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| TSCA | TSCA listed |
| Hazardous Substances Data | 128-42-7(Hazardous Substances Data) |







