BD2173648
Tetrakis(dimethyl(vinyl)silyl)orthosilicate , 98%mixTBCasstabilizer , 60111-54-8
CAS NO.:60111-54-8
Empirical Formula: C16H36O4Si5
Molecular Weight: 432.88
MDL number: MFCD00271023
EINECS: 262-061-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB80.00 | In Stock |
|
| 25g | RMB280.00 | In Stock |
|
| 100g | RMB924.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 130 °C |
| Density | 0.907±0.06 g/cm3(Predicted) |
| vapor pressure | 10Pa at 25℃ |
| refractive index | 1.4200 to 1.4240 |
| Flash point: | >100°C |
| storage temp. | 2-8°C, stored under nitrogen |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | 10ng/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/C16H36O4Si5/c1-13-21(5,6)17-25(18-22(7,8)14-2,19-23(9,10)15-3)20-24(11,12)16-4/h13-16H,1-4H2,5-12H3 |
| InChIKey | JMTMWSZLPHDWBQ-UHFFFAOYSA-N |
| SMILES | [Si](C=C)(C)(C)O[Si](O[Si](C=C)(C)C)(O[Si](C=C)(C)C)O[Si](C=C)(C)C |
| LogP | 9 at 20℃ |
| EPA Substance Registry System | Trisiloxane, 1,5-diethenyl-3,3-bis[(ethenyldimethylsilyl)oxy]-1,1,5,5-tetramethyl- (60111-54-8) |
Description and Uses
Tetrakis(vinyldimethylsiloxy)silane functions as a coupling agent, and also a useful reagent for various chemical reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| HS Code | 2931.90.9010 |







![1,3-Bis(2-(7-oxabicyclo[4.1.0]heptan-3-yl)ethyl)-1,1,3,3-tetramethyldisiloxane](https://img.chemicalbook.com/CAS/GIF/18724-32-8.gif)