BD2182548
7-Benzoylindolin-2-one , 97% , 51135-38-7
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2340.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 154℃ |
| Boiling point: | 501.7±50.0 °C(Predicted) |
| Density | 1.254±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 13.42±0.20(Predicted) |
| color | Pale Brown to Brown |
| Major Application | pharmaceutical (small molecules) |
| InChI | InChI=1S/C15H11NO2/c17-13-9-11-7-4-8-12(14(11)16-13)15(18)10-5-2-1-3-6-10/h1-8H,9H2,(H,16,17) |
| InChIKey | APGQYYFHBPQPTL-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2C(=O)C2=CC=CC=C2)CC1=O |
Description and Uses
7-Benzoyloxindole is an indole derivative with antiinflammatory activity. It is also a metabolite of amfenac (A576500).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |







