BD2193848
(S)-1-((S)-3-(Acetylthio)-2-methylpropanoyl)pyrrolidine-2-carboxylicacid , 90% , 64838-55-7
CAS NO.:64838-55-7
Empirical Formula: C11H17NO4S
Molecular Weight: 259.32
MDL number: MFCD00792449
EINECS: 265-250-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB167.20 | In Stock |
|
| 5g | RMB502.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-82 °C(lit.) |
| alpha | -158 º (c=1, MeOH) |
| Boiling point: | 464.8±40.0 °C(Predicted) |
| Density | 1.291±0.06 g/cm3(Predicted) |
| refractive index | -160 ° (C=1, MeOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.56±0.20(Predicted) |
| color | White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C11H17NO4S/c1-7(6-17-8(2)13)10(14)12-5-3-4-9(12)11(15)16/h7,9H,3-6H2,1-2H3,(H,15,16)/p-1/t7-,9+/m1/s1 |
| InChIKey | ZNQRGUYIKSRYCI-APPZFPTMSA-M |
| SMILES | S(C[C@@H](C)C(=O)N1[C@@H](CCC1)C(=O)[O-])C(=O)C |
| CAS DataBase Reference | 64838-55-7(CAS DataBase Reference) |
Description and Uses
(2S)-1-(3-Acetylthio-2-methyl-1-oxopropyl)-L-proline is used in the preparation of captopril derivatives, used as angiotensin converting enzymes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H361fd-H372 |
| Precautionary statements | P202-P260-P264-P280-P302+P352-P308+P313 |
| target organs | Kidney,Cardio-vascular system |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 24/25-26 |
| WGK Germany | 3 |
| HS Code | 2933.99.9701 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 2 Skin Sens. 1 STOT RE 1 Oral |





