BD2258848
4-Propoxybenzoicacid , 98% , 5438-19-7
Synonym(s):
p -Propoxybenzoic acid
| Pack Size | Price | Stock | Quantity |
| 5g | RMB67.20 | In Stock |
|
| 25g | RMB235.20 | In Stock |
|
| 100g | RMB775.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144-146 °C(lit.) |
| Boiling point: | 273.02°C (rough estimate) |
| Density | 1.1272 (rough estimate) |
| refractive index | 1.5160 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency[in hot Methanol] |
| solubility | almost transparency in hot Methanol |
| form | powder to crystal |
| pka | pK1:4.78 (20°C) |
| color | White to Almost white |
| Water Solubility | insoluble |
| BRN | 2208387 |
| InChI | InChI=1S/C10H12O3/c1-2-7-13-9-5-3-8(4-6-9)10(11)12/h3-6H,2,7H2,1H3,(H,11,12) |
| InChIKey | GDFUWFOCYZZGQU-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(OCCC)C=C1 |
| CAS DataBase Reference | 5438-19-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-n-Propoxybenzoic acid(5438-19-7) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-25-24-37-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |





