BD2288953
2-Ethoxy-5-fluoropyrimidin-4(3H)-one , 98% , 56177-80-1
Synonym(s):
2-Ethoxy-5-fluoropyrimidin-4(1H)-one;5-Fluoro-2-ethoxy-4(1H)pyrimidinone;Fluorouracil Impurity F (PhEur)
CAS NO.:56177-80-1
Empirical Formula: C6H7FN2O2
Molecular Weight: 158.13
MDL number: MFCD03265436
EINECS: 260-029-1
| Pack Size | Price | Stock | Quantity |
| 5g | RMB80.00 | In Stock |
|
| 25g | RMB219.20 | In Stock |
|
| 100g | RMB656.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 180-184 °C (lit.) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 6.45±0.50(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | 2g/L at 20℃ |
| InChI | InChI=1S/C6H7FN2O2/c1-2-11-6-8-3-4(7)5(10)9-6/h3H,2H2,1H3,(H,8,9,10) |
| InChIKey | XREDGJFKPWBNRQ-UHFFFAOYSA-N |
| SMILES | C1(OCC)=NC=C(F)C(=O)N1 |
| LogP | -0.96 at 25℃ |
| CAS DataBase Reference | 56177-80-1(CAS DataBase Reference) |
Description and Uses
Ethoxy-5-fluoro-4(3H)-pyrimidinone (Fluorouracil EP Impurity F) is a derivative of 5-fluorouracil (3C,15N2 labelled, F596002) which is a potent antineoplastic agent in clinical use.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |






