BD2372248
PyrantelTartrate , 98+% , 33401-94-4
CAS NO.：33401-94-4
Empirical Formula: C15H20N2O6S
Molecular Weight: 356.39
MDL number: MFCD00216022
EINECS: 251-501-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB223.20 | In Stock |
|
| 250mg | RMB287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 148-150° |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | H2O: soluble4.0ML, clear, colorless to faint yellow or tan (Solvent: 200 mg plus 4.0 mL ) |
| form | Solid |
| color | Light yellow to yellow |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C11H14N2S.C4H6O6/c1-13-8-3-7-12-11(13)6-5-10-4-2-9-14-10;5-1(3(7)8)2(6)4(9)10/h2,4-6,9H,3,7-8H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/b6-5+;/t;1-,2-/m.1/s1 |
| InChIKey | VWRCYAZJKNPEQR-NIEARKAZSA-N |
| SMILES | O[C@H]([C@@H](O)C(O)=O)C(O)=O.CN1CCCN=C1\C=C\c2cccs2 |
Description and Uses
Anthelmintic;Neuromuscular depolarizing agent
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UW0249000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2934990002 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | cattle,LD,unreported,> 200mg/kg (200mg/kg),Australian Veterinary Journal. Vol. 46, Pg. 297, 1970. |
