PRODUCT Properties
| Melting point: | 152 °C |
| Boiling point: | 422.5±14.0 °C(Predicted) |
| Density | 1.578±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| color | Pale Yellow to Yellow |
| InChI | InChI=1S/C16H9Br/c17-14-9-12-5-1-3-10-7-8-11-4-2-6-13(14)16(11)15(10)12/h1-9H |
| InChIKey | QMHTZTOPYZKQLC-UHFFFAOYSA-N |
| SMILES | C1=C2C3=C4C(C=C2)=CC=CC4=CC(Br)=C3C=C1 |
Description and Uses
4-Bromopyrene is an intermediate in the synthesis of Acepyrene (A130950), a novel constituent discovered that belongs to the pyrene class of the polycyclic aromatic hydrocarbons.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H413-H318 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| HS Code | 29039990 |
