PRODUCT Properties
| Boiling point: | 205.8°C (rough estimate) |
| Density | 1.6329 (rough estimate) |
| refractive index | 1.7330 (estimate) |
| storage temp. | 2-8°C |
| pka | -1.16±0.40(Predicted) |
| InChI | InChI=1S/C10H9NO6S2/c11-6-4-8-7(10(5-6)19(15,16)17)2-1-3-9(8)18(12,13)14/h1-5H,11H2,(H,12,13,14)(H,15,16,17) |
| InChIKey | MTJGVAJYTOXFJH-UHFFFAOYSA-N |
| SMILES | C1(S(O)(=O)=O)=C2C(C(S(O)(=O)=O)=CC=C2)=CC(N)=C1 |
| CAS DataBase Reference | 131-27-1(CAS DataBase Reference) |
| EPA Substance Registry System | 1,5-Naphthalenedisulfonic acid, 3-amino- (131-27-1) |
Description and Uses
2-Amino-4,8-naphthalenedisulfonic Acid is used in green preparation method of direct blended blue D 3GL.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| TSCA | TSCA listed |
| Toxicity | rat,LD50,oral,11400mg/kg (11400mg/kg),"Prehled Prumyslove Toxikologie; Organicke Latky," Marhold, J., Prague, Czechoslovakia, Avicenum, 1986Vol. -, Pg. 1058, 1986. |
