BD2520548
(R)-2-Phenylsuccinicacid , 97% , 46292-93-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB110.40 | In Stock |
|
| 1g | RMB236.80 | In Stock |
|
| 5g | RMB735.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173-176 °C |
| alpha | -175 º (c=1%, acetone) |
| Boiling point: | 290.62°C (rough estimate) |
| Density | 1.2534 (rough estimate) |
| refractive index | 1.5430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetone (Slightly), Methanol (Slightly) |
| pka | 3.60±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| optical activity | [α]20/D 175±4°, c = 1% in acetone |
| BRN | 3201702 |
| InChI | InChI=1S/C10H10O4/c11-9(12)6-8(10(13)14)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,11,12)(H,13,14)/t8-/m1/s1 |
| InChIKey | LVFFZQQWIZURIO-MRVPVSSYSA-N |
| SMILES | C(O)(=O)[C@@H](C1=CC=CC=C1)CC(O)=O |
| CAS DataBase Reference | 46292-93-7(CAS DataBase Reference) |
Description and Uses
(R)-Phenylsuccinic Acid is an intermediate used in the preparation of optically active succinic acid derivatives used as hypoglycemic agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2917399590 |
| Storage Class | 13 - Non Combustible Solids |
